C12H15N3O3 — CID 115168535
2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)ethylurea (PubChem CID 115168535) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)ethylurea.
| Compound Name | 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)ethylurea |
|---|---|
| PubChem CID | 115168535 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)ethylurea |
| SMILES | CC1Oc2ccc(CCNC(N)=O)cc2NC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-7-11(16)15-9-6-8(2-3-10(9)18-7)4-5-14-12(13)17/h2-3,6-7H,4-5H2,1H3,(H,15,16)(H3,13,14,17) |
| InChIKey | CDGJJESMLUYGKZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |