C11H12ClNO2 — CID 82255541
6-(2-chloroethyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 82255541) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 6-(2-chloroethyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloroethyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82255541 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-(2-chloroethyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(CCCl)cc2NC1=O |
| InChI | InChI=1S/C11H12ClNO2/c1-7-11(14)13-9-6-8(4-5-12)2-3-10(9)15-7/h2-3,6-7H,4-5H2,1H3,(H,13,14) |
| InChIKey | JRSHYLAPVKJABK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|