C11H11NO4 — CID 96672277
2-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]acetic acid (PubChem CID 96672277) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]acetic acid.
| Compound Name | 2-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 96672277 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]acetic acid |
| SMILES | C[C@H]1Oc2ccc(CC(=O)O)cc2NC1=O |
| InChI | InChI=1S/C11H11NO4/c1-6-11(15)12-8-4-7(5-10(13)14)2-3-9(8)16-6/h2-4,6H,5H2,1H3,(H,12,15)(H,13,14)/t6-/m1/s1 |
| InChIKey | HFPDYKOALACJHP-ZCFIWIBFSA-N |
| XLogP | 1.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |