C11H10N2O2 — CID 82469609
2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetonitrile (PubChem CID 82469609) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetonitrile.
| Compound Name | 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetonitrile |
|---|---|
| PubChem CID | 82469609 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetonitrile |
| SMILES | CC1Oc2ccc(CC#N)cc2NC1=O |
| InChI | InChI=1S/C11H10N2O2/c1-7-11(14)13-9-6-8(4-5-12)2-3-10(9)15-7/h2-3,6-7H,4H2,1H3,(H,13,14) |
| InChIKey | DINPWOAIAQHOOT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |