C17H28N3O4S+ — CID 7392802
1-(3-morpholin-4-ium-4-ylpropyl)-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 7392802) has the molecular formula C17H28N3O4S+ and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(3-morpholin-4-ium-4-ylpropyl)-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 7392802 |
| Molecular Formula | C17H28N3O4S+ |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)NCCC[NH+]2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H27N3O4S/c1-21-14-11-13(12-15(22-2)16(14)23-3)19-17(25)18-5-4-6-20-7-9-24-10-8-20/h11-12H,4-10H2,1-3H3,(H2,18,19,25)/p+1 |
| InChIKey | KDYPMLNJJJBVCE-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|