C19H30N3O3S+ — CID 8625065
butyl 4-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)benzoate (PubChem CID 8625065) has the molecular formula C19H30N3O3S+ and a molecular weight of 380.53 g/mol. Its IUPAC name is butyl 4-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)benzoate.
| Compound Name | butyl 4-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 8625065 |
| Molecular Formula | C19H30N3O3S+ |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | butyl 4-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NCCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-2-3-13-25-18(23)16-5-7-17(8-6-16)21-19(26)20-9-4-10-22-11-14-24-15-12-22/h5-8H,2-4,9-15H2,1H3,(H2,20,21,26)/p+1 |
| InChIKey | LLSMRTKZMZVPEC-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|