C16H26N5OS2+ — CID 8618793
1-(4-ethylphenyl)-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)thiourea (PubChem CID 8618793) has the molecular formula C16H26N5OS2+ and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8618793 |
| Molecular Formula | C16H26N5OS2+ |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)thiourea |
| SMILES | CCc1ccc(NC(=S)NNC(=S)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N5OS2/c1-2-13-3-5-14(6-4-13)18-16(24)20-19-15(23)17-7-8-21-9-11-22-12-10-21/h3-6H,2,7-12H2,1H3,(H2,17,19,23)(H2,18,20,24)/p+1 |
| InChIKey | BKLXXBYQEHAZIL-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|