C14H21N4O3S+ — CID 8620193
1-(4-methyl-3-nitrophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8620193) has the molecular formula C14H21N4O3S+ and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(4-methyl-3-nitrophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(4-methyl-3-nitrophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8620193 |
| Molecular Formula | C14H21N4O3S+ |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-(4-methyl-3-nitrophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCC[NH+]2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O3S/c1-11-2-3-12(10-13(11)18(19)20)16-14(22)15-4-5-17-6-8-21-9-7-17/h2-3,10H,4-9H2,1H3,(H2,15,16,22)/p+1 |
| InChIKey | SRRILVPNTQFGCB-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|