C17H27N4O2S+ — CID 8790841
N-(2,6-dimethylphenyl)-2-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)acetamide (PubChem CID 8790841) has the molecular formula C17H27N4O2S+ and a molecular weight of 351.50 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 8790841 |
| Molecular Formula | C17H27N4O2S+ |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(2-morpholin-4-ium-4-ylethylcarbamothioylamino)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-13-4-3-5-14(2)16(13)20-15(22)12-19-17(24)18-6-7-21-8-10-23-11-9-21/h3-5H,6-12H2,1-2H3,(H,20,22)(H2,18,19,24)/p+1 |
| InChIKey | JVHXRFOFXXNGBN-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|