C12H17N3OS — CID 8790815
N-(2,6-dimethylphenyl)-2-(methylcarbamothioylamino)acetamide (PubChem CID 8790815) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(methylcarbamothioylamino)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(methylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 8790815 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(methylcarbamothioylamino)acetamide |
| SMILES | CNC(=S)NCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C12H17N3OS/c1-8-5-4-6-9(2)11(8)15-10(16)7-14-12(17)13-3/h4-6H,7H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | VZWKPQFODMBLFG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|