C17H18FN3OS — CID 8790825
N-(2,6-dimethylphenyl)-2-[(4-fluorophenyl)carbamothioylamino]acetamide (PubChem CID 8790825) has the molecular formula C17H18FN3OS and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(4-fluorophenyl)carbamothioylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(4-fluorophenyl)carbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8790825 |
| Molecular Formula | C17H18FN3OS |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(4-fluorophenyl)carbamothioylamino]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3OS/c1-11-4-3-5-12(2)16(11)21-15(22)10-19-17(23)20-14-8-6-13(18)7-9-14/h3-9H,10H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | MCBPSKOPYDGWIE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|