C17H17ClFN3OS — CID 8790864
2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 8790864) has the molecular formula C17H17ClFN3OS and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8790864 |
| Molecular Formula | C17H17ClFN3OS |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClFN3OS/c1-10-4-3-5-11(2)16(10)22-15(23)9-20-17(24)21-12-6-7-14(19)13(18)8-12/h3-8H,9H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | VKDNVBLJCZXUEQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|