C22H26ClFN4OS — CID 74229439
2-[4-[(3-chloro-4-fluorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 74229439) has the molecular formula C22H26ClFN4OS and a molecular weight of 449.00 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-fluorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(3-chloro-4-fluorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 74229439 |
| Molecular Formula | C22H26ClFN4OS |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[4-[(3-chloro-4-fluorophenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCCN(C(=S)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H26ClFN4OS/c1-15-5-3-6-16(2)21(15)26-20(29)14-27-9-4-10-28(12-11-27)22(30)25-17-7-8-19(24)18(23)13-17/h3,5-8,13H,4,9-12,14H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | MYTZOKVMGKTVAU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|