C26H37N5OS — CID 74227491
2-[4-[[4-(diethylamino)phenyl]carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 74227491) has the molecular formula C26H37N5OS and a molecular weight of 467.68 g/mol. Its IUPAC name is 2-[4-[[4-(diethylamino)phenyl]carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[[4-(diethylamino)phenyl]carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 74227491 |
| Molecular Formula | C26H37N5OS |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-[4-[[4-(diethylamino)phenyl]carbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(NC(=S)N2CCCN(CC(=O)Nc3c(C)cccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H37N5OS/c1-5-30(6-2)23-13-11-22(12-14-23)27-26(33)31-16-8-15-29(17-18-31)19-24(32)28-25-20(3)9-7-10-21(25)4/h7,9-14H,5-6,8,15-19H2,1-4H3,(H,27,33)(H,28,32) |
| InChIKey | ASRJXWSKWQSRGK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|