C23H27F3N4OS — CID 74226449
N-(2,6-dimethylphenyl)-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 74226449) has the molecular formula C23H27F3N4OS and a molecular weight of 464.56 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 74226449 |
| Molecular Formula | C23H27F3N4OS |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCCN(C(=S)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H27F3N4OS/c1-16-7-5-8-17(2)21(16)28-20(31)15-29-11-6-12-30(14-13-29)22(32)27-19-10-4-3-9-18(19)23(24,25)26/h3-5,7-10H,6,11-15H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | FTGCKNCRDWLWSP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|