C20H22F3N3S — CID 19655090
4-(2,3-dimethylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 19655090) has the molecular formula C20H22F3N3S and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19655090 |
| Molecular Formula | C20H22F3N3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1cccc(N2CCN(C(=S)Nc3ccccc3C(F)(F)F)CC2)c1C |
| InChI | InChI=1S/C20H22F3N3S/c1-14-6-5-9-18(15(14)2)25-10-12-26(13-11-25)19(27)24-17-8-4-3-7-16(17)20(21,22)23/h3-9H,10-13H2,1-2H3,(H,24,27) |
| InChIKey | HUQYAWBYHJVVRC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|