C22H27N3O2S — CID 19655092
ethyl 4-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]benzoate (PubChem CID 19655092) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 4-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 19655092 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 4-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCN(c3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2S/c1-4-27-21(26)18-8-10-19(11-9-18)23-22(28)25-14-12-24(13-15-25)20-7-5-6-16(2)17(20)3/h5-11H,4,12-15H2,1-3H3,(H,23,28) |
| InChIKey | USOKOBLFBJUDFO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|