C22H28ClN3O4 — CID 108865707
[4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] ethyl carbonate;hydrochloride (PubChem CID 108865707) has the molecular formula C22H28ClN3O4 and a molecular weight of 433.94 g/mol. Its IUPAC name is [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] ethyl carbonate;hydrochloride.
| Compound Name | [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] ethyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 108865707 |
| Molecular Formula | C22H28ClN3O4 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] ethyl carbonate;hydrochloride |
| SMILES | CCOC(=O)Oc1ccc(NC(=O)N2CCN(c3cccc(C)c3C)CC2)cc1.Cl |
| InChI | InChI=1S/C22H27N3O4.ClH/c1-4-28-22(27)29-19-10-8-18(9-11-19)23-21(26)25-14-12-24(13-15-25)20-7-5-6-16(2)17(20)3;/h5-11H,4,12-15H2,1-3H3,(H,23,26);1H |
| InChIKey | XEVRXJRLIZJUEH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|