C21H28ClN3O2 — CID 108893074
4-(2,3-dimethylphenyl)-N-[(4-methylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride (PubChem CID 108893074) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[(4-methylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[(4-methylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 108893074 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[(4-methylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride |
| SMILES | Cc1ccc(OCNC(=O)N2CCN(c3cccc(C)c3C)CC2)cc1.Cl |
| InChI | InChI=1S/C21H27N3O2.ClH/c1-16-7-9-19(10-8-16)26-15-22-21(25)24-13-11-23(12-14-24)20-6-4-5-17(2)18(20)3;/h4-10H,11-15H2,1-3H3,(H,22,25);1H |
| InChIKey | UZCFVUYHDVIFBW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|