C22H30ClN3O2 — CID 108893447
4-(2,3-dimethylphenyl)-N-[(2-ethylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride (PubChem CID 108893447) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[(2-ethylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[(2-ethylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 108893447 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[(2-ethylphenoxy)methyl]piperazine-1-carboxamide;hydrochloride |
| SMILES | CCc1ccccc1OCNC(=O)N1CCN(c2cccc(C)c2C)CC1.Cl |
| InChI | InChI=1S/C22H29N3O2.ClH/c1-4-19-9-5-6-11-21(19)27-16-23-22(26)25-14-12-24(13-15-25)20-10-7-8-17(2)18(20)3;/h5-11H,4,12-16H2,1-3H3,(H,23,26);1H |
| InChIKey | PSKBGZJTALGRQA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|