C15H21N3O3 — CID 108893412
N-[(2-ethylphenoxy)methyl]-4-formylpiperazine-1-carboxamide (PubChem CID 108893412) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[(2-ethylphenoxy)methyl]-4-formylpiperazine-1-carboxamide.
| Compound Name | N-[(2-ethylphenoxy)methyl]-4-formylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108893412 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[(2-ethylphenoxy)methyl]-4-formylpiperazine-1-carboxamide |
| SMILES | CCc1ccccc1OCNC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-2-13-5-3-4-6-14(13)21-11-16-15(20)18-9-7-17(12-19)8-10-18/h3-6,12H,2,7-11H2,1H3,(H,16,20) |
| InChIKey | ZNVYVBKKSCPTTN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|