C15H21N3O5 — CID 108892416
methyl 4-[(2-methoxyphenoxy)methylcarbamoyl]piperazine-1-carboxylate (PubChem CID 108892416) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 4-[(2-methoxyphenoxy)methylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(2-methoxyphenoxy)methylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108892416 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl 4-[(2-methoxyphenoxy)methylcarbamoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)NCOc2ccccc2OC)CC1 |
| InChI | InChI=1S/C15H21N3O5/c1-21-12-5-3-4-6-13(12)23-11-16-14(19)17-7-9-18(10-8-17)15(20)22-2/h3-6H,7-11H2,1-2H3,(H,16,19) |
| InChIKey | QWXRJGWTWMLTRT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|