C15H20N2O5 — CID 110818263
methyl 4-(2,6-dimethoxybenzoyl)piperazine-1-carboxylate (PubChem CID 110818263) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl 4-(2,6-dimethoxybenzoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(2,6-dimethoxybenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818263 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl 4-(2,6-dimethoxybenzoyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C15H20N2O5/c1-20-11-5-4-6-12(21-2)13(11)14(18)16-7-9-17(10-8-16)15(19)22-3/h4-6H,7-10H2,1-3H3 |
| InChIKey | WFIHJGUAACVNPO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |