About 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride
4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride (PubChem CID 108813826) has the molecular formula C17H24ClN5O
and a molecular weight of 349.87 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride |
| PubChem CID | 108813826 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride |
| SMILES | Cc1cccc(N2CCN(C(=O)Nc3ccnn3C)CC2)c1C.Cl |
| InChI | InChI=1S/C17H23N5O.ClH/c1-13-5-4-6-15(14(13)2)21-9-11-22(12-10-21)17(23)19-16-7-8-18-20(16)3;/h4-8H,9-12H2,1-3H3,(H,19,23);1H |
| InChIKey | DMAJQGBKFWJTJV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride?
The IUPAC name of 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride (CID 108813826) is 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride.
What is the SMILES notation for 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride?
The canonical SMILES for 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride is Cc1cccc(N2CCN(C(=O)Nc3ccnn3C)CC2)c1C.Cl.
What is the InChIKey of 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride?
The InChIKey is DMAJQGBKFWJTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O.ClH/c1-13-5-4-6-15(14(13)2)21-9-11-22(12-10-21)17(23)19-16-7-8-18-20(16)3;/h4-8H,9-12H2,1-3H3,(H,19,23);1H.
What are the key properties of 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride?
4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride has a molecular weight of 349.87 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide;hydrochloride is sourced from PubChem (CID 108813826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).