C16H20N4O2 — CID 108812009
4-(2,3-dimethylphenyl)-N-(1,2-oxazol-3-yl)piperazine-1-carboxamide (PubChem CID 108812009) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-(1,2-oxazol-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-(1,2-oxazol-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108812009 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-(1,2-oxazol-3-yl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)Nc3ccon3)CC2)c1C |
| InChI | InChI=1S/C16H20N4O2/c1-12-4-3-5-14(13(12)2)19-7-9-20(10-8-19)16(21)17-15-6-11-22-18-15/h3-6,11H,7-10H2,1-2H3,(H,17,18,21) |
| InChIKey | KFMSXKTXYZMHDN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |