C20H24N4O2 — CID 51113389
N'-benzoyl-4-(2,3-dimethylphenyl)piperazine-1-carbohydrazide (PubChem CID 51113389) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N'-benzoyl-4-(2,3-dimethylphenyl)piperazine-1-carbohydrazide.
| Compound Name | N'-benzoyl-4-(2,3-dimethylphenyl)piperazine-1-carbohydrazide |
|---|---|
| PubChem CID | 51113389 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N'-benzoyl-4-(2,3-dimethylphenyl)piperazine-1-carbohydrazide |
| SMILES | Cc1cccc(N2CCN(C(=O)NNC(=O)c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C20H24N4O2/c1-15-7-6-10-18(16(15)2)23-11-13-24(14-12-23)20(26)22-21-19(25)17-8-4-3-5-9-17/h3-10H,11-14H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | ARSIQLOFXFQZQB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|