C17H23N5O2 — CID 154737898
4-(2-ethoxyphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide (PubChem CID 154737898) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-(2-ethoxyphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154737898 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-(2-ethoxyphenyl)-N-(2-methylpyrazol-3-yl)piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1N1CCN(C(=O)Nc2ccnn2C)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-3-24-15-7-5-4-6-14(15)21-10-12-22(13-11-21)17(23)19-16-8-9-18-20(16)2/h4-9H,3,10-13H2,1-2H3,(H,19,23) |
| InChIKey | NURJDXVUYHENGM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |