C21H25N3O4 — CID 113113699
methyl 2-[4-[(2-ethoxyphenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113113699) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 2-[4-[(2-ethoxyphenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 2-[4-[(2-ethoxyphenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113113699 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | methyl 2-[4-[(2-ethoxyphenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | CCOc1ccccc1NC(=O)N1CCN(c2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C21H25N3O4/c1-3-28-19-11-7-5-9-17(19)22-21(26)24-14-12-23(13-15-24)18-10-6-4-8-16(18)20(25)27-2/h4-11H,3,12-15H2,1-2H3,(H,22,26) |
| InChIKey | MFKXLMLDHNXYFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |