C19H20ClN3O3 — CID 113113008
methyl 2-[4-[(4-chlorophenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113113008) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is methyl 2-[4-[(4-chlorophenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 2-[4-[(4-chlorophenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113113008 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | methyl 2-[4-[(4-chlorophenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1CCN(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-26-18(24)16-4-2-3-5-17(16)22-10-12-23(13-11-22)19(25)21-15-8-6-14(20)7-9-15/h2-9H,10-13H2,1H3,(H,21,25) |
| InChIKey | QRKOMPTXGFHPIP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |