C23H32N6O2 — CID 122334873
4-[6-(azepan-1-yl)pyridazin-3-yl]-N-(2-ethoxyphenyl)piperazine-1-carboxamide (PubChem CID 122334873) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-[6-(azepan-1-yl)pyridazin-3-yl]-N-(2-ethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-(azepan-1-yl)pyridazin-3-yl]-N-(2-ethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122334873 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-[6-(azepan-1-yl)pyridazin-3-yl]-N-(2-ethoxyphenyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C23H32N6O2/c1-2-31-20-10-6-5-9-19(20)24-23(30)29-17-15-28(16-18-29)22-12-11-21(25-26-22)27-13-7-3-4-8-14-27/h5-6,9-12H,2-4,7-8,13-18H2,1H3,(H,24,30) |
| InChIKey | ASNCJJDSWMCTLO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |