C21H25F3N6O — CID 122334838
4-(6-piperidin-1-ylpyridazin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 122334838) has the molecular formula C21H25F3N6O and a molecular weight of 434.47 g/mol. Its IUPAC name is 4-(6-piperidin-1-ylpyridazin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(6-piperidin-1-ylpyridazin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122334838 |
| Molecular Formula | C21H25F3N6O |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-(6-piperidin-1-ylpyridazin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CCN(c2ccc(N3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C21H25F3N6O/c22-21(23,24)16-6-2-3-7-17(16)25-20(31)30-14-12-29(13-15-30)19-9-8-18(26-27-19)28-10-4-1-5-11-28/h2-3,6-9H,1,4-5,10-15H2,(H,25,31) |
| InChIKey | FDGHKSYGFZXTAM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |