C22H20F3N5O — CID 43992565
1-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 43992565) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 43992565 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(N3CCCC3)nn2)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N5O/c23-22(24,25)17-5-1-2-6-19(17)27-21(31)26-16-9-7-15(8-10-16)18-11-12-20(29-28-18)30-13-3-4-14-30/h1-2,5-12H,3-4,13-14H2,(H2,26,27,31) |
| InChIKey | DXDDUGHTUCAAHB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |