C23H23Cl2N5O — CID 43992316
1-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dichlorophenyl)urea (PubChem CID 43992316) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 43992316 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-(2,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H23Cl2N5O/c24-17-7-10-19(25)21(15-17)27-23(31)26-18-8-5-16(6-9-18)20-11-12-22(29-28-20)30-13-3-1-2-4-14-30/h5-12,15H,1-4,13-14H2,(H2,26,27,31) |
| InChIKey | PKHIXHKDMBFORI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |