C19H27F3N4O3S — CID 55696935
4-[cyclohexyl(methyl)sulfamoyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 55696935) has the molecular formula C19H27F3N4O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55696935 |
| Molecular Formula | C19H27F3N4O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H27F3N4O3S/c1-24(15-7-3-2-4-8-15)30(28,29)26-13-11-25(12-14-26)18(27)23-17-10-6-5-9-16(17)19(20,21)22/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3,(H,23,27) |
| InChIKey | OSKJJCVMXCMVQP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |