C17H22N2O2 — CID 121187160
4-cyclopropylidene-N-(2-ethoxyphenyl)piperidine-1-carboxamide (PubChem CID 121187160) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-cyclopropylidene-N-(2-ethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-cyclopropylidene-N-(2-ethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121187160 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-cyclopropylidene-N-(2-ethoxyphenyl)piperidine-1-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-21-16-6-4-3-5-15(16)18-17(20)19-11-9-14(10-12-19)13-7-8-13/h3-6H,2,7-12H2,1H3,(H,18,20) |
| InChIKey | DCMVPMWQUTUPTK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|