C20H31N3O5S — CID 91916489
N-(2-ethoxyphenyl)-4-(1-methylsulfonylpiperidin-4-yl)oxypiperidine-1-carboxamide (PubChem CID 91916489) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-4-(1-methylsulfonylpiperidin-4-yl)oxypiperidine-1-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-4-(1-methylsulfonylpiperidin-4-yl)oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 91916489 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-4-(1-methylsulfonylpiperidin-4-yl)oxypiperidine-1-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCC(OC2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C20H31N3O5S/c1-3-27-19-7-5-4-6-18(19)21-20(24)22-12-8-16(9-13-22)28-17-10-14-23(15-11-17)29(2,25)26/h4-7,16-17H,3,8-15H2,1-2H3,(H,21,24) |
| InChIKey | INLHJTBGCJQEJX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |