C19H25N3O3 — CID 60569814
4-(2-ethoxyphenyl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide (PubChem CID 60569814) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-ethoxyphenyl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60569814 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-(2-ethoxyphenyl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1N1CCN(C(=O)NCc2ccoc2C)CC1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-24-18-7-5-4-6-17(18)21-9-11-22(12-10-21)19(23)20-14-16-8-13-25-15(16)2/h4-8,13H,3,9-12,14H2,1-2H3,(H,20,23) |
| InChIKey | XSAJWUOXYHYVOU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |