C16H21N5O3 — CID 56826138
4-(4-methoxypyrimidin-2-yl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide (PubChem CID 56826138) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-(4-methoxypyrimidin-2-yl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxypyrimidin-2-yl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56826138 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-(4-methoxypyrimidin-2-yl)-N-[(2-methylfuran-3-yl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccnc(N2CCN(C(=O)NCc3ccoc3C)CC2)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-12-13(4-10-24-12)11-18-16(22)21-8-6-20(7-9-21)15-17-5-3-14(19-15)23-2/h3-5,10H,6-9,11H2,1-2H3,(H,18,22) |
| InChIKey | MDWFTXWCTVISAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |