C19H20N2O2S — CID 19686763
ethyl 4-(3,4-dihydro-2H-quinoline-1-carbothioylamino)benzoate (PubChem CID 19686763) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is ethyl 4-(3,4-dihydro-2H-quinoline-1-carbothioylamino)benzoate.
| Compound Name | ethyl 4-(3,4-dihydro-2H-quinoline-1-carbothioylamino)benzoate |
|---|---|
| PubChem CID | 19686763 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | ethyl 4-(3,4-dihydro-2H-quinoline-1-carbothioylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-2-23-18(22)15-9-11-16(12-10-15)20-19(24)21-13-5-7-14-6-3-4-8-17(14)21/h3-4,6,8-12H,2,5,7,13H2,1H3,(H,20,24) |
| InChIKey | QONNSSDJFVAWIL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|