C16H15BrN2S — CID 17298488
N-(4-bromophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 17298488) has the molecular formula C16H15BrN2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-(4-bromophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 17298488 |
| Molecular Formula | C16H15BrN2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-(4-bromophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Br)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H15BrN2S/c17-13-7-9-14(10-8-13)18-16(20)19-11-3-5-12-4-1-2-6-15(12)19/h1-2,4,6-10H,3,5,11H2,(H,18,20) |
| InChIKey | UKLHHMWWKZSBGQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|