C19H20N2OS — CID 26163816
N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-2-(2-methylphenyl)acetamide (PubChem CID 26163816) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-2-(2-methylphenyl)acetamide.
| Compound Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 26163816 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1CC(=O)NC(=S)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H20N2OS/c1-14-7-2-3-9-16(14)13-18(22)20-19(23)21-12-6-10-15-8-4-5-11-17(15)21/h2-5,7-9,11H,6,10,12-13H2,1H3,(H,20,22,23) |
| InChIKey | SDXCZBJIHFWIKD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|