C21H24N2O2S — CID 19188613
N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-4-(4-methylphenoxy)butanamide (PubChem CID 19188613) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-4-(4-methylphenoxy)butanamide.
| Compound Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 19188613 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)NC(=S)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-16-10-12-18(13-11-16)25-15-5-9-20(24)22-21(26)23-14-4-7-17-6-2-3-8-19(17)23/h2-3,6,8,10-13H,4-5,7,9,14-15H2,1H3,(H,22,24,26) |
| InChIKey | ZQZQRLMQKZTYPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|