C25H24N2O3S — CID 4955256
N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955256) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955256 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(3,4-dihydro-2H-quinoline-1-carbothioyl)-3-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)N1CCCc2ccccc21)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O3S/c28-24(26-25(31)27-15-7-10-19-8-4-5-14-23(19)27)20-9-6-13-22(18-20)30-17-16-29-21-11-2-1-3-12-21/h1-6,8-9,11-14,18H,7,10,15-17H2,(H,26,28,31) |
| InChIKey | QSLNCFXBXVPRII-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|