C17H16N2OS — CID 905190
N-(2,3-dihydroindole-1-carbothioyl)-3-methylbenzamide (PubChem CID 905190) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-(2,3-dihydroindole-1-carbothioyl)-3-methylbenzamide.
| Compound Name | N-(2,3-dihydroindole-1-carbothioyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 905190 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(2,3-dihydroindole-1-carbothioyl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=S)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H16N2OS/c1-12-5-4-7-14(11-12)16(20)18-17(21)19-10-9-13-6-2-3-8-15(13)19/h2-8,11H,9-10H2,1H3,(H,18,20,21) |
| InChIKey | MZADMQOOVXPXFA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|