C22H31N3O3S — CID 1258689
ethyl 4-[[4-(4-methylpiperidine-1-carbonyl)piperidine-1-carbothioyl]amino]benzoate (PubChem CID 1258689) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is ethyl 4-[[4-(4-methylpiperidine-1-carbonyl)piperidine-1-carbothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(4-methylpiperidine-1-carbonyl)piperidine-1-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 1258689 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethyl 4-[[4-(4-methylpiperidine-1-carbonyl)piperidine-1-carbothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCC(C(=O)N3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O3S/c1-3-28-21(27)18-4-6-19(7-5-18)23-22(29)25-14-10-17(11-15-25)20(26)24-12-8-16(2)9-13-24/h4-7,16-17H,3,8-15H2,1-2H3,(H,23,29) |
| InChIKey | VGIDYAYKDXQOEH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|