C16H19N3O2S — CID 2979797
ethyl 4-[(3-cyanopiperidine-1-carbothioyl)amino]benzoate (PubChem CID 2979797) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is ethyl 4-[(3-cyanopiperidine-1-carbothioyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-cyanopiperidine-1-carbothioyl)amino]benzoate |
|---|---|
| PubChem CID | 2979797 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | ethyl 4-[(3-cyanopiperidine-1-carbothioyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCCC(C#N)C2)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-21-15(20)13-5-7-14(8-6-13)18-16(22)19-9-3-4-12(10-17)11-19/h5-8,12H,2-4,9,11H2,1H3,(H,18,22) |
| InChIKey | HDXWFQQVRHLVBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|