C19H30N3O2S+ — CID 4603487
[1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methyl-propan-2-ylazanium (PubChem CID 4603487) has the molecular formula C19H30N3O2S+ and a molecular weight of 364.54 g/mol. Its IUPAC name is [1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methyl-propan-2-ylazanium.
| Compound Name | [1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 4603487 |
| Molecular Formula | C19H30N3O2S+ |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [1-[(4-ethoxycarbonylphenyl)carbamothioyl]piperidin-4-yl]-methyl-propan-2-ylazanium |
| SMILES | CCOC(=O)c1ccc(NC(=S)N2CCC([NH+](C)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29N3O2S/c1-5-24-18(23)15-6-8-16(9-7-15)20-19(25)22-12-10-17(11-13-22)21(4)14(2)3/h6-9,14,17H,5,10-13H2,1-4H3,(H,20,25)/p+1 |
| InChIKey | QSWCVSGVNKNHAR-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|