C21H31N3O3S — CID 46373049
ethyl 4-[[(1-acetylpiperidin-4-yl)-butylcarbamothioyl]amino]benzoate (PubChem CID 46373049) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is ethyl 4-[[(1-acetylpiperidin-4-yl)-butylcarbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[(1-acetylpiperidin-4-yl)-butylcarbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 46373049 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 4-[[(1-acetylpiperidin-4-yl)-butylcarbamothioyl]amino]benzoate |
| SMILES | CCCCN(C(=S)Nc1ccc(C(=O)OCC)cc1)C1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-4-6-13-24(19-11-14-23(15-12-19)16(3)25)21(28)22-18-9-7-17(8-10-18)20(26)27-5-2/h7-10,19H,4-6,11-15H2,1-3H3,(H,22,28) |
| InChIKey | FYWSJKSMIHDSJJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|