C20H31N3O3S — CID 46372350
ethyl 4-[(3,5-dimethylphenyl)carbamothioyl-(2-methoxyethyl)amino]piperidine-1-carboxylate (PubChem CID 46372350) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is ethyl 4-[(3,5-dimethylphenyl)carbamothioyl-(2-methoxyethyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3,5-dimethylphenyl)carbamothioyl-(2-methoxyethyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46372350 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl 4-[(3,5-dimethylphenyl)carbamothioyl-(2-methoxyethyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCOC)C(=S)Nc2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C20H31N3O3S/c1-5-26-20(24)22-8-6-18(7-9-22)23(10-11-25-4)19(27)21-17-13-15(2)12-16(3)14-17/h12-14,18H,5-11H2,1-4H3,(H,21,27) |
| InChIKey | SEPVVUUKDLGIGD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|