C20H31ClN4O2S — CID 12005254
ethyl 4-[(3-chloro-2-methylphenyl)carbamothioyl-[2-(dimethylamino)ethyl]amino]piperidine-1-carboxylate (PubChem CID 12005254) has the molecular formula C20H31ClN4O2S and a molecular weight of 427.01 g/mol. Its IUPAC name is ethyl 4-[(3-chloro-2-methylphenyl)carbamothioyl-[2-(dimethylamino)ethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-chloro-2-methylphenyl)carbamothioyl-[2-(dimethylamino)ethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 12005254 |
| Molecular Formula | C20H31ClN4O2S |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | ethyl 4-[(3-chloro-2-methylphenyl)carbamothioyl-[2-(dimethylamino)ethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCN(C)C)C(=S)Nc2cccc(Cl)c2C)CC1 |
| InChI | InChI=1S/C20H31ClN4O2S/c1-5-27-20(26)24-11-9-16(10-12-24)25(14-13-23(3)4)19(28)22-18-8-6-7-17(21)15(18)2/h6-8,16H,5,9-14H2,1-4H3,(H,22,28) |
| InChIKey | RXKNNYYVHUJWOS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|